Products 1330261-37-4
CAS 1330261-37-4 appears in our catalog under these names: Ropinirole-d4 Hydrochloride, >95% (HPLC), Ropinirole-d4 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-[2-[bis(1,1-dideuteriopropyl)amino]ethyl]-1,3-dihydroindol-2-one;hydrochloride (CAS 1330261-37-4) is a chemical compound with the molecular formula C16H25ClN2O and a molecular weight of 300.86 g/mol. IUPAC name: 4-[2-[bis(1,1-dideuteriopropyl)amino]ethyl]-1,3-dihydroindol-2-one;hydrochloride. InChIKey: XDXHAEQXIBQUEZ-PQDNHERISA-N.
| Molecular formula | C16H25ClN2O |
|---|---|
| Molecular weight | 300.86 g/mol |
| IUPAC name | 4-[2-[bis(1,1-dideuteriopropyl)amino]ethyl]-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | XDXHAEQXIBQUEZ-PQDNHERISA-N |
| SMILES | [2H]C([2H])(CC)N(CCC1=C2CC(=O)NC2=CC=C1)C([2H])([2H])CC.Cl |
Computed by PubChem (NCBI)