CAS 1653959-48-8 appears in our catalog under these names: Ezetimibe Impurity 106, 3-((E)-((4-Fluorophenyl)imino)methyl)phenol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
3-[(4-fluorophenyl)iminomethyl]phenol (CAS 1653959-48-8) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 215.22 g/mol. IUPAC name: 3-[(4-fluorophenyl)iminomethyl]phenol. InChIKey: VMABNWXQUYPGFH-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)iminomethyl]phenol |
| InChIKey | VMABNWXQUYPGFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C=NC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)