Products 1654736-67-0
CAS 1654736-67-0 is the registry number for Widdaranal A. Offered by: Chemat Brand. Available pack sizes: on request.
(4aS,9aR)-4a,9a-dimethyl-4-methylidene-1,2,3,5,8,9-hexahydrobenzo[7]annulene-7-carbaldehyde (CAS 1654736-67-0) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (4aS,9aR)-4a,9a-dimethyl-4-methylidene-1,2,3,5,8,9-hexahydrobenzo[7]annulene-7-carbaldehyde. InChIKey: WMBRJGSNTHYODE-CABCVRRESA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (4aS,9aR)-4a,9a-dimethyl-4-methylidene-1,2,3,5,8,9-hexahydrobenzo[7]annulene-7-carbaldehyde |
| InChIKey | WMBRJGSNTHYODE-CABCVRRESA-N |
| SMILES | C[C@]12CCCC(=C)[C@@]1(CC=C(CC2)C=O)C |
Computed by PubChem (NCBI)
Synonyms:
Widdaranal A