Products 1654766-16-1

CAS 1654766-16-1 is the registry number for 2,4-Bis(difluoromethyl)nicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,4-bis(difluoromethyl)pyridine-3-carboxylic acid (CAS 1654766-16-1) is a chemical compound with the molecular formula C8H5F4NO2 and a molecular weight of 223.12 g/mol. IUPAC name: 2,4-bis(difluoromethyl)pyridine-3-carboxylic acid. InChIKey: MAVVYBZVXRRMKN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F4NO2
Molecular weight223.12 g/mol
IUPAC name2,4-bis(difluoromethyl)pyridine-3-carboxylic acid
InChIKeyMAVVYBZVXRRMKN-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1C(F)F)C(=O)O)C(F)F

Computed by PubChem (NCBI)