CAS 165524-87-8 is the registry number for 4-O-Acetyl-3,6-di-O-benzyl-D-glucal. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
[(2R,3S,4R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-3-yl] acetate (CAS 165524-87-8) is a chemical compound with the molecular formula C22H24O5 and a molecular weight of 368.4 g/mol. IUPAC name: [(2R,3S,4R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-3-yl] acetate. InChIKey: GMASVJJCGAIRIV-VSKRKVRLSA-N.
| Molecular formula | C22H24O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | [(2R,3S,4R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-3-yl] acetate |
| InChIKey | GMASVJJCGAIRIV-VSKRKVRLSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H](C=CO[C@@H]1COCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)