Products 517885-72-2
CAS 517885-72-2 is the registry number for Dehydroglyasperin D. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
4-[5,7-dimethoxy-6-(3-methylbut-2-enyl)-2H-chromen-3-yl]benzene-1,3-diol (CAS 517885-72-2) is a chemical compound with the molecular formula C22H24O5 and a molecular weight of 368.4 g/mol. IUPAC name: 4-[5,7-dimethoxy-6-(3-methylbut-2-enyl)-2H-chromen-3-yl]benzene-1,3-diol. InChIKey: QHJJASRUTXHRAL-UHFFFAOYSA-N.
| Molecular formula | C22H24O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-[5,7-dimethoxy-6-(3-methylbut-2-enyl)-2H-chromen-3-yl]benzene-1,3-diol |
| InChIKey | QHJJASRUTXHRAL-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=C2C(=C1OC)C=C(CO2)C3=C(C=C(C=C3)O)O)OC)C |
Computed by PubChem (NCBI)