Products 4676-33-9
CAS 4676-33-9 is the registry number for DBF–6339. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 10g, 200mg, 2g, 20g, 500mg, 5g.
2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethylfuran (CAS 4676-33-9) is a chemical compound with the molecular formula C22H24O5 and a molecular weight of 368.4 g/mol. IUPAC name: 2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethylfuran. InChIKey: XNUMJZSIIZPBPX-UHFFFAOYSA-N.
| Molecular formula | C22H24O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethylfuran |
| InChIKey | XNUMJZSIIZPBPX-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=C1C)C2=CC(=C(C=C2)OC)OC)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)