CAS 16563-58-9 appears in our catalog under these names: 2H,3H,4H,5H-Naphtho(1,2-b)oxepin-5-one, 95%, 2H,3H,4H,5H-Naphtho(1,2-b)oxepin-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3,4-dihydro-2H-benzo[i][1]benzoxepin-5-one (CAS 16563-58-9) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 3,4-dihydro-2H-benzo[i][1]benzoxepin-5-one. InChIKey: LQCGIKXOHOFGRN-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 3,4-dihydro-2H-benzo[i][1]benzoxepin-5-one |
| InChIKey | LQCGIKXOHOFGRN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C3=CC=CC=C3C=C2)OC1 |
Computed by PubChem (NCBI)