Products 165730-10-9
CAS 165730-10-9 appears in our catalog under these names: 6-Bromo-2,2-dimethyl-2,3-dihydro-1H-inden-1-one, 6-Bromo-2,2-dimethyl-2,3-dihydro-1H-inden-1-one, 97%, 97%, 6-Bromo-2,2-dimethyl-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g.
6-bromo-2,2-dimethyl-3H-inden-1-one (CAS 165730-10-9) is a chemical compound with the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-3H-inden-1-one. InChIKey: ILFZPAUIJLEEAO-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-3H-inden-1-one |
| InChIKey | ILFZPAUIJLEEAO-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C1=O)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)