CAS 165739-63-9 appears in our catalog under these names: Desloratadine Impurity 21, 3-Methoxy Desloratadine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
13-chloro-6-methoxy-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (CAS 165739-63-9) is a chemical compound with the molecular formula C20H21ClN2O and a molecular weight of 340.8 g/mol. IUPAC name: 13-chloro-6-methoxy-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene. InChIKey: ARUFAUXFQSCDIE-UHFFFAOYSA-N.
| Molecular formula | C20H21ClN2O |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 13-chloro-6-methoxy-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| InChIKey | ARUFAUXFQSCDIE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C3CCNCC3)C4=C(CC2)C=C(C=C4)Cl)N=C1 |
Computed by PubChem (NCBI)