Products 959033-82-0

CAS 959033-82-0 appears in our catalog under these names: 3-(1-Adamantyl)-1-phenyl-1h-pyrazole-4-carbonyl chloride, 95%, 3-(Adamantan-1-yl)-1-phenyl-1H-pyrazole-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(1-adamantyl)-1-phenylpyrazole-4-carbonyl chloride (CAS 959033-82-0) is a chemical compound with the molecular formula C20H21ClN2O and a molecular weight of 340.8 g/mol. IUPAC name: 3-(1-adamantyl)-1-phenylpyrazole-4-carbonyl chloride. InChIKey: INEDDSUCCYEMAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21ClN2O
Molecular weight340.8 g/mol
IUPAC name3-(1-adamantyl)-1-phenylpyrazole-4-carbonyl chloride
InChIKeyINEDDSUCCYEMAJ-UHFFFAOYSA-N
SMILESC1C2CC3CC1CC(C2)(C3)C4=NN(C=C4C(=O)Cl)C5=CC=CC=C5

Computed by PubChem (NCBI)