CAS 64169-57-9 is the registry number for Citalopram Impurity 39. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1-(4-chlorophenyl)-1-[3-(dimethylamino)propyl]-3H-2-benzofuran-5-carbonitrile (CAS 64169-57-9) is a chemical compound with the molecular formula C20H21ClN2O and a molecular weight of 340.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-1-[3-(dimethylamino)propyl]-3H-2-benzofuran-5-carbonitrile. InChIKey: HYIJPACNNYCMRP-UHFFFAOYSA-N.
| Molecular formula | C20H21ClN2O |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-1-[3-(dimethylamino)propyl]-3H-2-benzofuran-5-carbonitrile |
| InChIKey | HYIJPACNNYCMRP-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)