CAS 166096-47-5 appears in our catalog under these names: 2-(3-Chlorophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(3-Chlorophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-chlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 166096-47-5) is a chemical compound with the molecular formula C15H8ClNO4 and a molecular weight of 301.68 g/mol. IUPAC name: 2-(3-chlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: ABFLDFICOGECPZ-UHFFFAOYSA-N.
| Molecular formula | C15H8ClNO4 |
|---|---|
| Molecular weight | 301.68 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | ABFLDFICOGECPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)