CAS 63591-89-9 is the registry number for 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 4-chlorobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
(1,3-dioxoisoindol-2-yl) 4-chlorobenzoate (CAS 63591-89-9) is a chemical compound with the molecular formula C15H8ClNO4 and a molecular weight of 301.68 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 4-chlorobenzoate. InChIKey: ZIBXHQBHUBKJGH-UHFFFAOYSA-N.
| Molecular formula | C15H8ClNO4 |
|---|---|
| Molecular weight | 301.68 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 4-chlorobenzoate |
| InChIKey | ZIBXHQBHUBKJGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OC(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)