CAS 285552-81-0 is the registry number for 2-(4-Chloro-phenyl)-1,3-dioxo-2,3-dihydro-1h-isoindole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 285552-81-0) is a chemical compound with the molecular formula C15H8ClNO4 and a molecular weight of 301.68 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: VNHFPPONXAFBPE-UHFFFAOYSA-N.
| Molecular formula | C15H8ClNO4 |
|---|---|
| Molecular weight | 301.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | VNHFPPONXAFBPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O)Cl |
Computed by PubChem (NCBI)