CAS 166096-53-3 appears in our catalog under these names: 2-(4-Ethoxy-phenyl)-1,3-dioxo-2,3-dihydro-1h-isoindole-5-carboxylic acid, 95%, 2-(4-Ethoxyphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 166096-53-3) is a chemical compound with the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. IUPAC name: 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: FZYOJDVYADHXGY-UHFFFAOYSA-N.
| Molecular formula | C17H13NO5 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | FZYOJDVYADHXGY-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)