Products 2375197-79-6
CAS 2375197-79-6 is the registry number for Germinone A. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methyl-2-(2-nitro-4-phenylphenoxy)-2H-furan-5-one (CAS 2375197-79-6) is a chemical compound with the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. IUPAC name: 4-methyl-2-(2-nitro-4-phenylphenoxy)-2H-furan-5-one. InChIKey: KEACYGRJKSMAJH-UHFFFAOYSA-N.
| Molecular formula | C17H13NO5 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | 4-methyl-2-(2-nitro-4-phenylphenoxy)-2H-furan-5-one |
| InChIKey | KEACYGRJKSMAJH-UHFFFAOYSA-N |
| SMILES | CC1=CC(OC1=O)OC2=C(C=C(C=C2)C3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)