Products 2651958-71-1
CAS 2651958-71-1 is the registry number for (E)-4-(3-(4-Methyl-3-nitrophenyl)-3-oxoprop-1-en-1-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-3-(4-methyl-3-nitrophenyl)-3-oxoprop-1-enyl]benzoic acid (CAS 2651958-71-1) is a chemical compound with the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. IUPAC name: 4-[(E)-3-(4-methyl-3-nitrophenyl)-3-oxoprop-1-enyl]benzoic acid. InChIKey: CIWIUUICQAIRCO-WEVVVXLNSA-N.
| Molecular formula | C17H13NO5 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | 4-[(E)-3-(4-methyl-3-nitrophenyl)-3-oxoprop-1-enyl]benzoic acid |
| InChIKey | CIWIUUICQAIRCO-WEVVVXLNSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)