CAS 166239-06-1 is the registry number for (S)-2-bromo-1-(4-nitrophenyl)ethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(1S)-2-bromo-1-(4-nitrophenyl)ethanol (CAS 166239-06-1) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: (1S)-2-bromo-1-(4-nitrophenyl)ethanol. InChIKey: LZCQQYQFJPLEBE-MRVPVSSYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | (1S)-2-bromo-1-(4-nitrophenyl)ethanol |
| InChIKey | LZCQQYQFJPLEBE-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CBr)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)