CAS 166275-25-8 appears in our catalog under these names: (4S,5S)-3,3-Difluoro-4-hydroxy-5-(hydroxymethyl)dihydrofuran-2(3H)-one, 98%, 2-Deoxy-2,2-difluoro -L-threo-pentonic Acid gamma-Lactone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(4S,5S)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-one (CAS 166275-25-8) is a chemical compound with the molecular formula C5H6F2O4 and a molecular weight of 168.10 g/mol. IUPAC name: (4S,5S)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-one. InChIKey: FBXJTMLCLDWDQO-HRFVKAFMSA-N.
| Molecular formula | C5H6F2O4 |
|---|---|
| Molecular weight | 168.10 g/mol |
| IUPAC name | (4S,5S)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-one |
| InChIKey | FBXJTMLCLDWDQO-HRFVKAFMSA-N |
| SMILES | C([C@H]1[C@@H](C(C(=O)O1)(F)F)O)O |
Computed by PubChem (NCBI)