Products 54404-52-3

CAS 54404-52-3 is the registry number for 3-Ethoxy-2,2-difluoro-3-oxopropanoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

3-ethoxy-2,2-difluoro-3-oxopropanoic acid (CAS 54404-52-3) is a chemical compound with the molecular formula C5H6F2O4 and a molecular weight of 168.10 g/mol. IUPAC name: 3-ethoxy-2,2-difluoro-3-oxopropanoic acid. InChIKey: FIUWHFOSVAXXFV-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6F2O4
Molecular weight168.10 g/mol
IUPAC name3-ethoxy-2,2-difluoro-3-oxopropanoic acid
InChIKeyFIUWHFOSVAXXFV-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(=O)O)(F)F

Computed by PubChem (NCBI)