Products 2757731-71-6

CAS 2757731-71-6 appears in our catalog under these names: 3,3-Difluoro-2-oxopent-4-enoic acid hydrate 95%, 3,3-Difluoro-2-oxopent-4-enoic acid hydrate, 95%, 95%, 3,3-Difluoro-2-oxopent-4-enoic acid hydrate, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3,3-difluoro-2-oxopent-4-enoic acid;hydrate (CAS 2757731-71-6) is a chemical compound with the molecular formula C5H6F2O4 and a molecular weight of 168.10 g/mol. IUPAC name: 3,3-difluoro-2-oxopent-4-enoic acid;hydrate. InChIKey: IRZSRYWTVXOVFL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6F2O4
Molecular weight168.10 g/mol
IUPAC name3,3-difluoro-2-oxopent-4-enoic acid;hydrate
InChIKeyIRZSRYWTVXOVFL-UHFFFAOYSA-N
SMILESC=CC(C(=O)C(=O)O)(F)F.O

Computed by PubChem (NCBI)