Products 166331-65-3
CAS 166331-65-3 is the registry number for 2-Chloro-6-isopropylnicotinic acid, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
2-chloro-6-propan-2-ylpyridine-3-carboxylic acid (CAS 166331-65-3) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2-chloro-6-propan-2-ylpyridine-3-carboxylic acid. InChIKey: JFFDBWXZMOAYBN-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 2-chloro-6-propan-2-ylpyridine-3-carboxylic acid |
| InChIKey | JFFDBWXZMOAYBN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)