CAS 16635-95-3 appears in our catalog under these names: (±)–1,2–Diphenylethylenediamine, DL-1,2-Diphenyl-1,2-ethanediamine, (+/-)-1,2-Diphenylethylenediamine, >98.0%(T), (1R,2R)-rel-1,2-Diphenylethane-1,2-diamine, 98%, 98%. Offered by: GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 2g, 5g, 10g, 1g.
1,2-diphenylethane-1,2-diamine (CAS 16635-95-3) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 1,2-diphenylethane-1,2-diamine. InChIKey: PONXTPCRRASWKW-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 1,2-diphenylethane-1,2-diamine |
| InChIKey | PONXTPCRRASWKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(C2=CC=CC=C2)N)N |
Computed by PubChem (NCBI)