CAS 5700-60-7 appears in our catalog under these names: 1,2-Diphenylethane-1,2-Diamine, 98%, 98%, 1,2-Diphenylethane-1,2-diamine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100g, 250mg, 1g, 5g, 25g, 100mg.
(1R,2S)-1,2-diphenylethane-1,2-diamine (CAS 5700-60-7) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: (1R,2S)-1,2-diphenylethane-1,2-diamine. InChIKey: PONXTPCRRASWKW-OKILXGFUSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | (1R,2S)-1,2-diphenylethane-1,2-diamine |
| InChIKey | PONXTPCRRASWKW-OKILXGFUSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@H](C2=CC=CC=C2)N)N |
Computed by PubChem (NCBI)