CAS 1664-63-7 appears in our catalog under these names: 2-Aminocinnamic acid, 95%, 2–Aminocinnamic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
(E)-3-(2-aminophenyl)prop-2-enoic acid (CAS 1664-63-7) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (E)-3-(2-aminophenyl)prop-2-enoic acid. InChIKey: KMBQKHKEEHEPOE-AATRIKPKSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (E)-3-(2-aminophenyl)prop-2-enoic acid |
| InChIKey | KMBQKHKEEHEPOE-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)N |
Computed by PubChem (NCBI)