CAS 16641-51-3 is the registry number for 8-Epiasterolide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4aS,8aR,9aR)-3,8a-dimethyl-5-methylidene-4a,6,7,8,9,9a-hexahydro-4H-benzo[f][1]benzofuran-2-one (CAS 16641-51-3) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: (4aS,8aR,9aR)-3,8a-dimethyl-5-methylidene-4a,6,7,8,9,9a-hexahydro-4H-benzo[f][1]benzofuran-2-one. InChIKey: OQYBLUDOOFOBPO-GZBFAFLISA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (4aS,8aR,9aR)-3,8a-dimethyl-5-methylidene-4a,6,7,8,9,9a-hexahydro-4H-benzo[f][1]benzofuran-2-one |
| InChIKey | OQYBLUDOOFOBPO-GZBFAFLISA-N |
| SMILES | CC1=C2C[C@H]3C(=C)CCC[C@@]3(C[C@H]2OC1=O)C |
Computed by PubChem (NCBI)