Products 16668-00-1
CAS 16668-00-1 is the registry number for (2R,3R,4S,5R,6R)-2-(Hydroxymethyl)-6-methoxytetrahydro-2H-pyran-3,4,5-triyl triacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] acetate (CAS 16668-00-1) is a chemical compound with the molecular formula C13H20O9 and a molecular weight of 320.29 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] acetate. InChIKey: OBVFJYUDIWPVKD-UJPOAAIJSA-N.
| Molecular formula | C13H20O9 |
|---|---|
| Molecular weight | 320.29 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] acetate |
| InChIKey | OBVFJYUDIWPVKD-UJPOAAIJSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](O[C@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC)CO |
Computed by PubChem (NCBI)