CAS 31873-37-7 appears in our catalog under these names: (2R,3R,4S,5R,6R)–6–(acetoxymethyl)–5–hydroxy–2–methoxytetrahydro–2H–pyran–3,4–diyl diacetate, Methyl 2,3,6-tri-O-acetyl-β-D-glucopyranoside. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 2g, 500mg, 5g.
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-3-hydroxy-6-methoxyoxan-2-yl]methyl acetate (CAS 31873-37-7) is a chemical compound with the molecular formula C13H20O9 and a molecular weight of 320.29 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-3-hydroxy-6-methoxyoxan-2-yl]methyl acetate. InChIKey: SZWIADUEFWYSBL-UJPOAAIJSA-N.
| Molecular formula | C13H20O9 |
|---|---|
| Molecular weight | 320.29 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-3-hydroxy-6-methoxyoxan-2-yl]methyl acetate |
| InChIKey | SZWIADUEFWYSBL-UJPOAAIJSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC)OC(=O)C)OC(=O)C)O |
Computed by PubChem (NCBI)