Products 38982-58-0
CAS 38982-58-0 is the registry number for Methyl 2,3,4-tri-O-acetyl-β-D-galactopyranoside. Offered by: Chemat. Available pack sizes: 1g, 250mg, 2g, 500mg.
[(2R,3S,4S,5R,6R)-4,5-diacetyloxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] acetate (CAS 38982-58-0) is a chemical compound with the molecular formula C13H20O9 and a molecular weight of 320.29 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] acetate. InChIKey: OBVFJYUDIWPVKD-KSSYENDESA-N.
| Molecular formula | C13H20O9 |
|---|---|
| Molecular weight | 320.29 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] acetate |
| InChIKey | OBVFJYUDIWPVKD-KSSYENDESA-N |
| SMILES | CC(=O)O[C@H]1[C@H](O[C@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC)CO |
Computed by PubChem (NCBI)