CAS 16672-15-4 appears in our catalog under these names: 3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-ol, 95%, 3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(2-chlorophenyl)-4H-1,2,4-oxadiazol-5-one (CAS 16672-15-4) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 3-(2-chlorophenyl)-4H-1,2,4-oxadiazol-5-one. InChIKey: KICRLMZFAZGWTM-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-4H-1,2,4-oxadiazol-5-one |
| InChIKey | KICRLMZFAZGWTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=O)N2)Cl |
Computed by PubChem (NCBI)