CAS 166744-78-1 appears in our catalog under these names: 4–(benzyloxy)–2–fluorophenylboronic acid, 4-Benzyloxy-2-fluorophenylboronic Acid (contains varying amounts of Anhydride), 4-(Benzyloxy)-2-fluorophenylboronic acid, 97%, anhydride present , 4-Benzyloxy-2-fluorophenylboronic acid, 98%, 98%, 4-Benzyloxy-2-fluorophenylboronic acid, 96%. Offered by: GLPBio, TCI, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 200mg, 250MG, 10g, 100mg.
(2-fluoro-4-phenylmethoxyphenyl)boronic acid (CAS 166744-78-1) is a chemical compound with the molecular formula C13H12BFO3 and a molecular weight of 246.04 g/mol. IUPAC name: (2-fluoro-4-phenylmethoxyphenyl)boronic acid. InChIKey: PQWKGFALWCOVTC-UHFFFAOYSA-N.
| Molecular formula | C13H12BFO3 |
|---|---|
| Molecular weight | 246.04 g/mol |
| IUPAC name | (2-fluoro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | PQWKGFALWCOVTC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)