CAS 16691-00-2 appears in our catalog under these names: 3,3'-((2S,5S)-3,6-Dioxopiperazine-2,5-diyl)dipropionic acid, 98%, Cyclo(–Glu–Glu), Cyclo(-Glu-Glu), 3,3'-((2S,5S)-3,6-Dioxopiperazine-2,5-diyl)dipropionic acid, ≥96%, ≥96%. Offered by: Chemat Brand, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 250mg, 50mg, 100mg, 500mg, Get quote.
3-[(2S,5S)-5-(2-carboxyethyl)-3,6-dioxopiperazin-2-yl]propanoic acid (CAS 16691-00-2) is a chemical compound with the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. IUPAC name: 3-[(2S,5S)-5-(2-carboxyethyl)-3,6-dioxopiperazin-2-yl]propanoic acid. InChIKey: NDCKGUDRHBPJAQ-WDSKDSINSA-N.
| Molecular formula | C10H14N2O6 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 3-[(2S,5S)-5-(2-carboxyethyl)-3,6-dioxopiperazin-2-yl]propanoic acid |
| InChIKey | NDCKGUDRHBPJAQ-WDSKDSINSA-N |
| SMILES | C(CC(=O)O)[C@H]1C(=O)N[C@H](C(=O)N1)CCC(=O)O |
Computed by PubChem (NCBI)