CAS 29227-92-7 appears in our catalog under these names: Pidotimod Impurity 24, Magnesium pidolate EP Impurity B,Pidotimod Impurity 15, N-(5-Oxo-L-prolyl)-L-glutamic Acid, (2S)-2-{((2S)-5-Oxopyrrolidin-2-yl)formamido}pentanedioic acid, (2S)-2-{[(2S)-5-oxopyrrolidin-2-yl]formamido}pentanedioic acid, 97%, 97%. Offered by: Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: on request, 2,5g, 0,5g, 50mg, 100mg, 250mg, 1g.
(2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanedioic acid (CAS 29227-92-7) is a chemical compound with the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. IUPAC name: (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanedioic acid. InChIKey: YRUFRJRFQFBNQR-WDSKDSINSA-N.
| Molecular formula | C10H14N2O6 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanedioic acid |
| InChIKey | YRUFRJRFQFBNQR-WDSKDSINSA-N |
| SMILES | C1CC(=O)N[C@@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)