CAS 31448-54-1 appears in our catalog under these names: Sofosbuvir Impurity 122, 2'–C–methyluridine, 2'-C-Methyluridine, >98.0%(HPLC), 2'-C-Methyluridine, 2'-C-methyluridine, 97%, 97%. Offered by: Chemat Brand, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: on request, 10g, 1g, 25g, 5g, 250mg, 0,5g, 2g.
1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione (CAS 31448-54-1) is a chemical compound with the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione. InChIKey: NBKORJKMMVZAOZ-VPCXQMTMSA-N.
| Molecular formula | C10H14N2O6 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | NBKORJKMMVZAOZ-VPCXQMTMSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)CO)O)O |
Computed by PubChem (NCBI)