Products 1669434-94-9
CAS 1669434-94-9 is the registry number for R-Methylenedioxypyrovalerone Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
(2R)-1-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylpentan-1-one;hydrochloride (CAS 1669434-94-9) is a chemical compound with the molecular formula C16H22ClNO3 and a molecular weight of 311.80 g/mol. IUPAC name: (2R)-1-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylpentan-1-one;hydrochloride. InChIKey: PYQZNWFQAMFAMT-BTQNPOSSSA-N.
| Molecular formula | C16H22ClNO3 |
|---|---|
| Molecular weight | 311.80 g/mol |
| IUPAC name | (2R)-1-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylpentan-1-one;hydrochloride |
| InChIKey | PYQZNWFQAMFAMT-BTQNPOSSSA-N |
| SMILES | CCC[C@H](C(=O)C1=CC2=C(C=C1)OCO2)N3CCCC3.Cl |
Computed by PubChem (NCBI)