Products 167011-35-0

CAS 167011-35-0 appears in our catalog under these names: Tetrahydro-2H-thiopyran-3-carboxylic acid 1,1-dioxide, 98+%, tetrahydro–2H–thiopyran–3–carboxylic acid 1,1–dioxide, Tetrahydro-​2H-​thiopyran-​3-​carboxylic acid 1,​1-​dioxide. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,1-dioxothiane-3-carboxylic acid (CAS 167011-35-0) is a chemical compound with the molecular formula C6H10O4S and a molecular weight of 178.21 g/mol. IUPAC name: 1,1-dioxothiane-3-carboxylic acid. InChIKey: UGIYZUNKFKCETD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10O4S
Molecular weight178.21 g/mol
IUPAC name1,1-dioxothiane-3-carboxylic acid
InChIKeyUGIYZUNKFKCETD-UHFFFAOYSA-N
SMILESC1CC(CS(=O)(=O)C1)C(=O)O

Computed by PubChem (NCBI)