Products 64096-87-3

CAS 64096-87-3 appears in our catalog under these names: Tetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide, Tetrahydro-2H-thiopyran-4-carboxylic Acid 1,1-Dioxide, >98.0%(T), Tetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide 97%, Tetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide, 98+%, 98+%, Tetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide, 97%. Offered by: Biosynth, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g, 250g.

Structural formula: {0} (CAS {1})

1,1-dioxothiane-4-carboxylic acid (CAS 64096-87-3) is a chemical compound with the molecular formula C6H10O4S and a molecular weight of 178.21 g/mol. IUPAC name: 1,1-dioxothiane-4-carboxylic acid. InChIKey: RPJRJUVGGDVVDF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10O4S
Molecular weight178.21 g/mol
IUPAC name1,1-dioxothiane-4-carboxylic acid
InChIKeyRPJRJUVGGDVVDF-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCC1C(=O)O

Computed by PubChem (NCBI)