Products 2381121-52-2

CAS 2381121-52-2 is the registry number for (S)-2-(1,1-Dioxidotetrahydrothiophen-3-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(3S)-1,1-dioxothiolan-3-yl]acetic acid (CAS 2381121-52-2) is a chemical compound with the molecular formula C6H10O4S and a molecular weight of 178.21 g/mol. IUPAC name: 2-[(3S)-1,1-dioxothiolan-3-yl]acetic acid. InChIKey: BWWAVFYRWZYKFE-RXMQYKEDSA-N.

Identity
Molecular formulaC6H10O4S
Molecular weight178.21 g/mol
IUPAC name2-[(3S)-1,1-dioxothiolan-3-yl]acetic acid
InChIKeyBWWAVFYRWZYKFE-RXMQYKEDSA-N
SMILESC1CS(=O)(=O)C[C@H]1CC(=O)O

Computed by PubChem (NCBI)