CAS 2381121-52-2 is the registry number for (S)-2-(1,1-Dioxidotetrahydrothiophen-3-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3S)-1,1-dioxothiolan-3-yl]acetic acid (CAS 2381121-52-2) is a chemical compound with the molecular formula C6H10O4S and a molecular weight of 178.21 g/mol. IUPAC name: 2-[(3S)-1,1-dioxothiolan-3-yl]acetic acid. InChIKey: BWWAVFYRWZYKFE-RXMQYKEDSA-N.
| Molecular formula | C6H10O4S |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 2-[(3S)-1,1-dioxothiolan-3-yl]acetic acid |
| InChIKey | BWWAVFYRWZYKFE-RXMQYKEDSA-N |
| SMILES | C1CS(=O)(=O)C[C@H]1CC(=O)O |
Computed by PubChem (NCBI)