CAS 167095-10-5 appears in our catalog under these names: 5-Aminotetramethyl Rhodamine, 5-Amino TAMRA. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 10mg, 2mg, 5mg, 25mg, 50mg.
6-amino-3',6'-bis(dimethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 167095-10-5) is a chemical compound with the molecular formula C24H23N3O3 and a molecular weight of 401.5 g/mol. IUPAC name: 6-amino-3',6'-bis(dimethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: SCDBRTCWHLGIMU-UHFFFAOYSA-N.
| Molecular formula | C24H23N3O3 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 6-amino-3',6'-bis(dimethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | SCDBRTCWHLGIMU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)N)C(=O)O3)C5=C(O2)C=C(C=C5)N(C)C |
Computed by PubChem (NCBI)