Products 80724-18-1
CAS 80724-18-1 is the registry number for 4-Amino-2-(3,6-Bis(Dimethylamino)Xanthylium-9-Yl)Benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg.
4-amino-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate (CAS 80724-18-1) is a chemical compound with the molecular formula C24H23N3O3 and a molecular weight of 401.5 g/mol. IUPAC name: 4-amino-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate. InChIKey: HJAKLXHVIVAHAX-UHFFFAOYSA-N.
| Molecular formula | C24H23N3O3 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 4-amino-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate |
| InChIKey | HJAKLXHVIVAHAX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=CC(=C4)N)C(=O)[O-] |
Computed by PubChem (NCBI)