CAS 80724-17-0 is the registry number for Xanthylium, 9-(4-amino-2-carboxyphenyl)-3,6-bis(dimethylamino)-, inner salt, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg.
6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-iminocyclohexa-1,4-diene-1-carboxylic acid (CAS 80724-17-0) is a chemical compound with the molecular formula C24H23N3O3 and a molecular weight of 401.5 g/mol. IUPAC name: 6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-iminocyclohexa-1,4-diene-1-carboxylic acid. InChIKey: ACARQHQBFSFTSN-UHFFFAOYSA-N.
| Molecular formula | C24H23N3O3 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-iminocyclohexa-1,4-diene-1-carboxylic acid |
| InChIKey | ACARQHQBFSFTSN-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=N)C=C3C(=O)O)C4=C(O2)C=C(C=C4)N(C)C |
Computed by PubChem (NCBI)