Products 16713-66-9
CAS 16713-66-9 appears in our catalog under these names: 1,1-Cyclopentanediacetic acid, 95%, 1,1-Cyclopentanediacetic Acid, 3，3–Tetramethyleneglutaric acid, 1,1-Cyclopentanediacetic Acid, >98.0%(GC)(T), 2,2-(Cyclopentane-1,1-diyl)diacetic acid 98%. Offered by: Combi-blocks, Chemat Brand, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 100g, 25g, 5g, on request, 500g, 10g.
2-[1-(carboxymethyl)cyclopentyl]acetic acid (CAS 16713-66-9) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: 2-[1-(carboxymethyl)cyclopentyl]acetic acid. InChIKey: FWPVKDFOUXHOKQ-UHFFFAOYSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 2-[1-(carboxymethyl)cyclopentyl]acetic acid |
| InChIKey | FWPVKDFOUXHOKQ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1,1-Cyclopentanediacetic acid, Tetramethylene glutaric acid, 3,3'-tetramethyleneglutaric acid, 3,3-Tetramethyleneglutaric acid, Cyclopentane-1,1-diacetic acid, 2-[1-(carboxymethyl)cyclopentyl]acetic acid, 2,2'-(Cyclopentane-1,1-diyl)diacetic acid, Cyclopentanediacetic acid, Tetramethyleneglutaric acid, 2,2-(Cyclopentane-1,1-diyl)diacetic acid