Products 55556-66-6
CAS 55556-66-6 appears in our catalog under these names: t-Butyl methyl fumarate, 97%, tert–Butyl methyl fumarat, t-Butyl methyl fumarate, tert-Butyl methyl fumarate 97%, tert-Butyl methyl fumarate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 2,5g, 100mg, 500mg.
4-O-tert-butyl 1-O-methyl (E)-but-2-enedioate (CAS 55556-66-6) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl (E)-but-2-enedioate. InChIKey: LEKWCGTZPGQABT-AATRIKPKSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl (E)-but-2-enedioate |
| InChIKey | LEKWCGTZPGQABT-AATRIKPKSA-N |
| SMILES | CC(C)(C)OC(=O)/C=C/C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
t-Butyl methyl fumarate, TERT-BUTYL METHYL FUMARATE, t-Butyl Methyl Fumarate ( >90%), 2-Butenedioic acid (2E)-, 1,1-dimethylethyl methyl ester, 4-O-tert-butyl 1-O-methyl (E)-but-2-enedioate, t-Butylmethylfumarate, methyl-t-butyl fumarate, tert-Butyl methyl fumarat, O4-tert-butyl O1-methyl (E)-but-2-enedioate, 2-Butenedioic acid (2E)-, 1-(1,1-dimethylethyl) 4-methyl ester