CAS 733742-58-0 appears in our catalog under these names: Cis-3-carbomethoxycyclohexane-1-carboxylic acid, 95%, cis-3-Carbomethoxycyclohexane-1-carboxylic acid, cis-3-(Methoxycarbonyl)cyclohexanecarboxylic acid, 98%, 98%, cis-3-(Methoxycarbonyl)cyclohexanecarboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 2,5g, 100mg, 5g.
Cis-(1R,3S)-3-methoxycarbonylcyclohexane-1-carboxylic acid (CAS 733742-58-0) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: cis-(1R,3S)-3-methoxycarbonylcyclohexane-1-carboxylic acid. InChIKey: PODOUIALODEQFA-RQJHMYQMSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | cis-(1R,3S)-3-methoxycarbonylcyclohexane-1-carboxylic acid |
| InChIKey | PODOUIALODEQFA-RQJHMYQMSA-N |
| SMILES | COC(=O)[C@H]1CCC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)