Products 1672-76-0

CAS 1672-76-0 is the registry number for Chlorpromazine N-oxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide (CAS 1672-76-0) is a chemical compound with the molecular formula C17H19ClN2OS and a molecular weight of 334.9 g/mol. IUPAC name: 3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide. InChIKey: LFDFWIIFGRXCFR-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19ClN2OS
Molecular weight334.9 g/mol
IUPAC name3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide
InChIKeyLFDFWIIFGRXCFR-UHFFFAOYSA-N
SMILESC[N+](C)(CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl)[O-]

Computed by PubChem (NCBI)