CAS 1672-76-0 is the registry number for Chlorpromazine N-oxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide (CAS 1672-76-0) is a chemical compound with the molecular formula C17H19ClN2OS and a molecular weight of 334.9 g/mol. IUPAC name: 3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide. InChIKey: LFDFWIIFGRXCFR-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2OS |
|---|---|
| Molecular weight | 334.9 g/mol |
| IUPAC name | 3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide |
| InChIKey | LFDFWIIFGRXCFR-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl)[O-] |
Computed by PubChem (NCBI)