CAS 3926-67-8 appears in our catalog under these names: 8-Hydroxychlorpromazine, 8-Hydroxy Chlorpromazine. Offered by: MedChemExpress, Chemat Brand. Available pack sizes: Get quote, on request.
8-chloro-10-[3-(dimethylamino)propyl]phenothiazin-2-ol (CAS 3926-67-8) is a chemical compound with the molecular formula C17H19ClN2OS and a molecular weight of 334.9 g/mol. IUPAC name: 8-chloro-10-[3-(dimethylamino)propyl]phenothiazin-2-ol. InChIKey: UBUDVAYGFVRZCO-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2OS |
|---|---|
| Molecular weight | 334.9 g/mol |
| IUPAC name | 8-chloro-10-[3-(dimethylamino)propyl]phenothiazin-2-ol |
| InChIKey | UBUDVAYGFVRZCO-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C2=C(C=CC(=C2)O)SC3=C1C=C(C=C3)Cl |
Computed by PubChem (NCBI)