CAS 21740-97-6 appears in our catalog under these names: Etifoxine Impurity 1, 1-(4-Chloro-2-(1’-hydroxy-1’-methylbenzyl)phenyl)-3-ethyl-2-thio-urea. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 50mg.
1-[4-chloro-2-(1-hydroxy-1-phenylethyl)phenyl]-3-ethylthiourea (CAS 21740-97-6) is a chemical compound with the molecular formula C17H19ClN2OS and a molecular weight of 334.9 g/mol. IUPAC name: 1-[4-chloro-2-(1-hydroxy-1-phenylethyl)phenyl]-3-ethylthiourea. InChIKey: PSQXUHVOOSIWTL-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2OS |
|---|---|
| Molecular weight | 334.9 g/mol |
| IUPAC name | 1-[4-chloro-2-(1-hydroxy-1-phenylethyl)phenyl]-3-ethylthiourea |
| InChIKey | PSQXUHVOOSIWTL-UHFFFAOYSA-N |
| SMILES | CCNC(=S)NC1=C(C=C(C=C1)Cl)C(C)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)