CAS 1672665-31-4 is the registry number for 4-Fluoro-7-(methylsulfonyl)-2,3-dihydrospiro[indene-1,2'-[1,3]dioxolane], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-fluoro-4-methylsulfonylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane] (CAS 1672665-31-4) is a chemical compound with the molecular formula C12H13FO4S and a molecular weight of 272.29 g/mol. IUPAC name: 7-fluoro-4-methylsulfonylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane]. InChIKey: YTDWKYGARUAMMW-UHFFFAOYSA-N.
| Molecular formula | C12H13FO4S |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 7-fluoro-4-methylsulfonylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane] |
| InChIKey | YTDWKYGARUAMMW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C2C(=C(C=C1)F)CCC23OCCO3 |
Computed by PubChem (NCBI)