CAS 2490705-21-8 is the registry number for 4-(3-fluorophenyl)tetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
4-(3-fluorophenyl)-1,1-dioxothiane-4-carboxylic acid (CAS 2490705-21-8) is a chemical compound with the molecular formula C12H13FO4S and a molecular weight of 272.29 g/mol. IUPAC name: 4-(3-fluorophenyl)-1,1-dioxothiane-4-carboxylic acid. InChIKey: WYSZLTMKNMPDOX-UHFFFAOYSA-N.
| Molecular formula | C12H13FO4S |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 4-(3-fluorophenyl)-1,1-dioxothiane-4-carboxylic acid |
| InChIKey | WYSZLTMKNMPDOX-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(C2=CC(=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)